C22H39NO3S — CID 155197652
3,4-dihydroxy-N,N-dioctylbenzenesulfinamide (PubChem CID 155197652) has the molecular formula C22H39NO3S and a molecular weight of 397.63 g/mol. Its IUPAC name is 3,4-dihydroxy-N,N-dioctylbenzenesulfinamide.
| Compound Name | 3,4-dihydroxy-N,N-dioctylbenzenesulfinamide |
|---|---|
| PubChem CID | 155197652 |
| Molecular Formula | C22H39NO3S |
| Molecular Weight | 397.63 g/mol |
| Exact Mass | 397.27 |
| IUPAC Name | 3,4-dihydroxy-N,N-dioctylbenzenesulfinamide |
| SMILES | CCCCCCCCN(CCCCCCCC)S(=O)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C22H39NO3S/c1-3-5-7-9-11-13-17-23(18-14-12-10-8-6-4-2)27(26)20-15-16-21(24)22(25)19-20/h15-16,19,24-25H,3-14,17-18H2,1-2H3 |
| InChIKey | ZULBVGYSOQSGRH-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.63 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|