C21H29NO4S — CID 59350324
N-benzyl-3,4-dihydroxy-N-octylbenzenesulfonamide (PubChem CID 59350324) has the molecular formula C21H29NO4S and a molecular weight of 391.53 g/mol. Its IUPAC name is N-benzyl-3,4-dihydroxy-N-octylbenzenesulfonamide.
| Compound Name | N-benzyl-3,4-dihydroxy-N-octylbenzenesulfonamide |
|---|---|
| PubChem CID | 59350324 |
| Molecular Formula | C21H29NO4S |
| Molecular Weight | 391.53 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | N-benzyl-3,4-dihydroxy-N-octylbenzenesulfonamide |
| SMILES | CCCCCCCCN(Cc1ccccc1)S(=O)(=O)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C21H29NO4S/c1-2-3-4-5-6-10-15-22(17-18-11-8-7-9-12-18)27(25,26)19-13-14-20(23)21(24)16-19/h7-9,11-14,16,23-24H,2-6,10,15,17H2,1H3 |
| InChIKey | ISRNMDNSERNCCU-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.53 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|