C19H25FN2O4S2 — CID 25472305
4-N-[(4-fluorophenyl)methyl]-1-N-methyl-4-N-pentylbenzene-1,4-disulfonamide (PubChem CID 25472305) has the molecular formula C19H25FN2O4S2 and a molecular weight of 428.55 g/mol. Its IUPAC name is 4-N-[(4-fluorophenyl)methyl]-1-N-methyl-4-N-pentylbenzene-1,4-disulfonamide.
| Compound Name | 4-N-[(4-fluorophenyl)methyl]-1-N-methyl-4-N-pentylbenzene-1,4-disulfonamide |
|---|---|
| PubChem CID | 25472305 |
| Molecular Formula | C19H25FN2O4S2 |
| Molecular Weight | 428.55 g/mol |
| Exact Mass | 428.12 |
| IUPAC Name | 4-N-[(4-fluorophenyl)methyl]-1-N-methyl-4-N-pentylbenzene-1,4-disulfonamide |
| SMILES | CCCCCN(Cc1ccc(F)cc1)S(=O)(=O)c1ccc(S(=O)(=O)NC)cc1 |
| InChI | InChI=1S/C19H25FN2O4S2/c1-3-4-5-14-22(15-16-6-8-17(20)9-7-16)28(25,26)19-12-10-18(11-13-19)27(23,24)21-2/h6-13,21H,3-5,14-15H2,1-2H3 |
| InChIKey | KUBRUEANSLZBAS-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.55 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|