C19H23BrFNO4S2 — CID 60568267
2-bromo-N-[(4-fluorophenyl)methyl]-5-methylsulfonyl-N-pentylbenzenesulfonamide (PubChem CID 60568267) has the molecular formula C19H23BrFNO4S2 and a molecular weight of 492.43 g/mol. Its IUPAC name is 2-bromo-N-[(4-fluorophenyl)methyl]-5-methylsulfonyl-N-pentylbenzenesulfonamide.
| Compound Name | 2-bromo-N-[(4-fluorophenyl)methyl]-5-methylsulfonyl-N-pentylbenzenesulfonamide |
|---|---|
| PubChem CID | 60568267 |
| Molecular Formula | C19H23BrFNO4S2 |
| Molecular Weight | 492.43 g/mol |
| Exact Mass | 491.02 |
| IUPAC Name | 2-bromo-N-[(4-fluorophenyl)methyl]-5-methylsulfonyl-N-pentylbenzenesulfonamide |
| SMILES | CCCCCN(Cc1ccc(F)cc1)S(=O)(=O)c1cc(S(C)(=O)=O)ccc1Br |
| InChI | InChI=1S/C19H23BrFNO4S2/c1-3-4-5-12-22(14-15-6-8-16(21)9-7-15)28(25,26)19-13-17(27(2,23)24)10-11-18(19)20/h6-11,13H,3-5,12,14H2,1-2H3 |
| InChIKey | PTUZQEZCDXNALS-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.43 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|