C20H23FN2O6S — CID 46371362
ethyl 5-[(4-fluorophenyl)methyl-(3-nitrophenyl)sulfonylamino]pentanoate (PubChem CID 46371362) has the molecular formula C20H23FN2O6S and a molecular weight of 438.48 g/mol. Its IUPAC name is ethyl 5-[(4-fluorophenyl)methyl-(3-nitrophenyl)sulfonylamino]pentanoate.
| Compound Name | ethyl 5-[(4-fluorophenyl)methyl-(3-nitrophenyl)sulfonylamino]pentanoate |
|---|---|
| PubChem CID | 46371362 |
| Molecular Formula | C20H23FN2O6S |
| Molecular Weight | 438.48 g/mol |
| Exact Mass | 438.13 |
| IUPAC Name | ethyl 5-[(4-fluorophenyl)methyl-(3-nitrophenyl)sulfonylamino]pentanoate |
| SMILES | CCOC(=O)CCCCN(Cc1ccc(F)cc1)S(=O)(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H23FN2O6S/c1-2-29-20(24)8-3-4-13-22(15-16-9-11-17(21)12-10-16)30(27,28)19-7-5-6-18(14-19)23(25)26/h5-7,9-12,14H,2-4,8,13,15H2,1H3 |
| InChIKey | ODZVEYVEFGVRTG-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 106.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.48 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|