C12H16N2O6S — CID 61072138
methyl 2-[(3-nitrophenyl)sulfonyl-propylamino]acetate (PubChem CID 61072138) has the molecular formula C12H16N2O6S and a molecular weight of 316.34 g/mol. Its IUPAC name is methyl 2-[(3-nitrophenyl)sulfonyl-propylamino]acetate.
| Compound Name | methyl 2-[(3-nitrophenyl)sulfonyl-propylamino]acetate |
|---|---|
| PubChem CID | 61072138 |
| Molecular Formula | C12H16N2O6S |
| Molecular Weight | 316.34 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | methyl 2-[(3-nitrophenyl)sulfonyl-propylamino]acetate |
| SMILES | CCCN(CC(=O)OC)S(=O)(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H16N2O6S/c1-3-7-13(9-12(15)20-2)21(18,19)11-6-4-5-10(8-11)14(16)17/h4-6,8H,3,7,9H2,1-2H3 |
| InChIKey | GBSSGLYAURCRFW-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 106.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.34 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|