C17H18N2O6S — CID 100520692
methyl 2-(3,4-dimethyl-N-(3-nitrophenyl)sulfonylanilino)acetate (PubChem CID 100520692) has the molecular formula C17H18N2O6S and a molecular weight of 378.41 g/mol. Its IUPAC name is methyl 2-(3,4-dimethyl-N-(3-nitrophenyl)sulfonylanilino)acetate.
| Compound Name | methyl 2-(3,4-dimethyl-N-(3-nitrophenyl)sulfonylanilino)acetate |
|---|---|
| PubChem CID | 100520692 |
| Molecular Formula | C17H18N2O6S |
| Molecular Weight | 378.41 g/mol |
| Exact Mass | 378.09 |
| IUPAC Name | methyl 2-(3,4-dimethyl-N-(3-nitrophenyl)sulfonylanilino)acetate |
| SMILES | COC(=O)CN(c1ccc(C)c(C)c1)S(=O)(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H18N2O6S/c1-12-7-8-14(9-13(12)2)18(11-17(20)25-3)26(23,24)16-6-4-5-15(10-16)19(21)22/h4-10H,11H2,1-3H3 |
| InChIKey | QXNKDLBRWHBYLI-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 106.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.41 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|