About propan-2-yl 2-(3-methyl-N-(3-nitrophenyl)sulfonylanilino)acetate
propan-2-yl 2-(3-methyl-N-(3-nitrophenyl)sulfonylanilino)acetate (PubChem CID 50889976) has the molecular formula C18H20N2O6S
and a molecular weight of 392.43 g/mol. Its IUPAC name is propan-2-yl 2-(3-methyl-N-(3-nitrophenyl)sulfonylanilino)acetate.
Molecular Properties
| Compound Name | propan-2-yl 2-(3-methyl-N-(3-nitrophenyl)sulfonylanilino)acetate |
| PubChem CID | 50889976 |
| Molecular Formula | C18H20N2O6S |
| Molecular Weight | 392.43 g/mol |
| Exact Mass | 392.10 |
| IUPAC Name | propan-2-yl 2-(3-methyl-N-(3-nitrophenyl)sulfonylanilino)acetate |
| SMILES | Cc1cccc(N(CC(=O)OC(C)C)S(=O)(=O)c2cccc([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C18H20N2O6S/c1-13(2)26-18(21)12-19(15-7-4-6-14(3)10-15)27(24,25)17-9-5-8-16(11-17)20(22)23/h4-11,13H,12H2,1-3H3 |
| InChIKey | ZXYJIPSOKYAQJM-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 106.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.43 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze propan-2-yl 2-(3-methyl-N-(3-nitrophenyl)sulfonylanilino)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl 2-(3-methyl-N-(3-nitrophenyl)sulfonylanilino)acetate?
The IUPAC name of propan-2-yl 2-(3-methyl-N-(3-nitrophenyl)sulfonylanilino)acetate (CID 50889976) is propan-2-yl 2-(3-methyl-N-(3-nitrophenyl)sulfonylanilino)acetate.
What is the SMILES notation for propan-2-yl 2-(3-methyl-N-(3-nitrophenyl)sulfonylanilino)acetate?
The canonical SMILES for propan-2-yl 2-(3-methyl-N-(3-nitrophenyl)sulfonylanilino)acetate is Cc1cccc(N(CC(=O)OC(C)C)S(=O)(=O)c2cccc([N+](=O)[O-])c2)c1.
What is the InChIKey of propan-2-yl 2-(3-methyl-N-(3-nitrophenyl)sulfonylanilino)acetate?
The InChIKey is ZXYJIPSOKYAQJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20N2O6S/c1-13(2)26-18(21)12-19(15-7-4-6-14(3)10-15)27(24,25)17-9-5-8-16(11-17)20(22)23/h4-11,13H,12H2,1-3H3.
What are the key properties of propan-2-yl 2-(3-methyl-N-(3-nitrophenyl)sulfonylanilino)acetate?
propan-2-yl 2-(3-methyl-N-(3-nitrophenyl)sulfonylanilino)acetate has a molecular weight of 392.43 g/mol, XLogP of 3.05, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl 2-(3-methyl-N-(3-nitrophenyl)sulfonylanilino)acetate is sourced from PubChem (CID 50889976), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).