C18H16ClF3N2O6S — CID 50893738
propan-2-yl 2-[2-chloro-N-(3-nitrophenyl)sulfonyl-5-(trifluoromethyl)anilino]acetate (PubChem CID 50893738) has the molecular formula C18H16ClF3N2O6S and a molecular weight of 480.85 g/mol. Its IUPAC name is propan-2-yl 2-[2-chloro-N-(3-nitrophenyl)sulfonyl-5-(trifluoromethyl)anilino]acetate.
| Compound Name | propan-2-yl 2-[2-chloro-N-(3-nitrophenyl)sulfonyl-5-(trifluoromethyl)anilino]acetate |
|---|---|
| PubChem CID | 50893738 |
| Molecular Formula | C18H16ClF3N2O6S |
| Molecular Weight | 480.85 g/mol |
| Exact Mass | 480.04 |
| IUPAC Name | propan-2-yl 2-[2-chloro-N-(3-nitrophenyl)sulfonyl-5-(trifluoromethyl)anilino]acetate |
| SMILES | CC(C)OC(=O)CN(c1cc(C(F)(F)F)ccc1Cl)S(=O)(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H16ClF3N2O6S/c1-11(2)30-17(25)10-23(16-8-12(18(20,21)22)6-7-15(16)19)31(28,29)14-5-3-4-13(9-14)24(26)27/h3-9,11H,10H2,1-2H3 |
| InChIKey | OPZKZTVENFCNFC-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 106.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.85 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|