C17H16Cl3NO4S — CID 50895363
propan-2-yl 2-[N-(benzenesulfonyl)-2,4,5-trichloroanilino]acetate (PubChem CID 50895363) has the molecular formula C17H16Cl3NO4S and a molecular weight of 436.74 g/mol. Its IUPAC name is propan-2-yl 2-[N-(benzenesulfonyl)-2,4,5-trichloroanilino]acetate.
| Compound Name | propan-2-yl 2-[N-(benzenesulfonyl)-2,4,5-trichloroanilino]acetate |
|---|---|
| PubChem CID | 50895363 |
| Molecular Formula | C17H16Cl3NO4S |
| Molecular Weight | 436.74 g/mol |
| Exact Mass | 434.99 |
| IUPAC Name | propan-2-yl 2-[N-(benzenesulfonyl)-2,4,5-trichloroanilino]acetate |
| SMILES | CC(C)OC(=O)CN(c1cc(Cl)c(Cl)cc1Cl)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C17H16Cl3NO4S/c1-11(2)25-17(22)10-21(16-9-14(19)13(18)8-15(16)20)26(23,24)12-6-4-3-5-7-12/h3-9,11H,10H2,1-2H3 |
| InChIKey | XEMGBTFLTKJCCV-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.74 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|