C14H11Cl3N2O3S — CID 50895400
2-[N-(benzenesulfonyl)-2,4,5-trichloroanilino]acetamide (PubChem CID 50895400) has the molecular formula C14H11Cl3N2O3S and a molecular weight of 393.68 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-2,4,5-trichloroanilino]acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-2,4,5-trichloroanilino]acetamide |
|---|---|
| PubChem CID | 50895400 |
| Molecular Formula | C14H11Cl3N2O3S |
| Molecular Weight | 393.68 g/mol |
| Exact Mass | 391.96 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-2,4,5-trichloroanilino]acetamide |
| SMILES | NC(=O)CN(c1cc(Cl)c(Cl)cc1Cl)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C14H11Cl3N2O3S/c15-10-6-12(17)13(7-11(10)16)19(8-14(18)20)23(21,22)9-4-2-1-3-5-9/h1-7H,8H2,(H2,18,20) |
| InChIKey | ITXPCAUHGFWIGK-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.68 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|