C14H10BrCl3N2O3S — CID 50895749
2-(N-(4-bromophenyl)sulfonyl-2,4,5-trichloroanilino)acetamide (PubChem CID 50895749) has the molecular formula C14H10BrCl3N2O3S and a molecular weight of 472.58 g/mol. Its IUPAC name is 2-(N-(4-bromophenyl)sulfonyl-2,4,5-trichloroanilino)acetamide.
| Compound Name | 2-(N-(4-bromophenyl)sulfonyl-2,4,5-trichloroanilino)acetamide |
|---|---|
| PubChem CID | 50895749 |
| Molecular Formula | C14H10BrCl3N2O3S |
| Molecular Weight | 472.58 g/mol |
| Exact Mass | 469.87 |
| IUPAC Name | 2-(N-(4-bromophenyl)sulfonyl-2,4,5-trichloroanilino)acetamide |
| SMILES | NC(=O)CN(c1cc(Cl)c(Cl)cc1Cl)S(=O)(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C14H10BrCl3N2O3S/c15-8-1-3-9(4-2-8)24(22,23)20(7-14(19)21)13-6-11(17)10(16)5-12(13)18/h1-6H,7H2,(H2,19,21) |
| InChIKey | LFODWEYFRAKVBD-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.58 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|