C14H9Cl5N2O3S — CID 50895755
2-(2,4,5-trichloro-N-(2,5-dichlorophenyl)sulfonylanilino)acetamide (PubChem CID 50895755) has the molecular formula C14H9Cl5N2O3S and a molecular weight of 462.57 g/mol. Its IUPAC name is 2-(2,4,5-trichloro-N-(2,5-dichlorophenyl)sulfonylanilino)acetamide.
| Compound Name | 2-(2,4,5-trichloro-N-(2,5-dichlorophenyl)sulfonylanilino)acetamide |
|---|---|
| PubChem CID | 50895755 |
| Molecular Formula | C14H9Cl5N2O3S |
| Molecular Weight | 462.57 g/mol |
| Exact Mass | 459.88 |
| IUPAC Name | 2-(2,4,5-trichloro-N-(2,5-dichlorophenyl)sulfonylanilino)acetamide |
| SMILES | NC(=O)CN(c1cc(Cl)c(Cl)cc1Cl)S(=O)(=O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C14H9Cl5N2O3S/c15-7-1-2-8(16)13(3-7)25(23,24)21(6-14(20)22)12-5-10(18)9(17)4-11(12)19/h1-5H,6H2,(H2,20,22) |
| InChIKey | JKCLYUUDMUJVIV-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.57 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|