C8H7Cl2NO3S — CID 13344609
2-(2,5-dichlorophenyl)sulfonylacetamide (PubChem CID 13344609) has the molecular formula C8H7Cl2NO3S and a molecular weight of 268.12 g/mol. Its IUPAC name is 2-(2,5-dichlorophenyl)sulfonylacetamide.
| Compound Name | 2-(2,5-dichlorophenyl)sulfonylacetamide |
|---|---|
| PubChem CID | 13344609 |
| Molecular Formula | C8H7Cl2NO3S |
| Molecular Weight | 268.12 g/mol |
| Exact Mass | 266.95 |
| IUPAC Name | 2-(2,5-dichlorophenyl)sulfonylacetamide |
| SMILES | NC(=O)CS(=O)(=O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C8H7Cl2NO3S/c9-5-1-2-6(10)7(3-5)15(13,14)4-8(11)12/h1-3H,4H2,(H2,11,12) |
| InChIKey | IUOFURVPQVBUIA-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.12 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |