C9H8Cl2O3S — CID 130493441
(2S)-2-[(2,5-dichlorophenyl)sulfonylmethyl]oxirane (PubChem CID 130493441) has the molecular formula C9H8Cl2O3S and a molecular weight of 267.13 g/mol. Its IUPAC name is (2S)-2-[(2,5-dichlorophenyl)sulfonylmethyl]oxirane.
| Compound Name | (2S)-2-[(2,5-dichlorophenyl)sulfonylmethyl]oxirane |
|---|---|
| PubChem CID | 130493441 |
| Molecular Formula | C9H8Cl2O3S |
| Molecular Weight | 267.13 g/mol |
| Exact Mass | 265.96 |
| IUPAC Name | (2S)-2-[(2,5-dichlorophenyl)sulfonylmethyl]oxirane |
| SMILES | O=S(=O)(C[C@@H]1CO1)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C9H8Cl2O3S/c10-6-1-2-8(11)9(3-6)15(12,13)5-7-4-14-7/h1-3,7H,4-5H2/t7-/m0/s1 |
| InChIKey | SKDYEHRKERVGDM-ZETCQYMHSA-N |
| XLogP | 2.17 |
| TPSA | 46.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.13 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|