C9H8Cl2O4S — CID 131857575
[(2S)-oxiran-2-yl]methyl 2,5-dichlorobenzenesulfonate (PubChem CID 131857575) has the molecular formula C9H8Cl2O4S and a molecular weight of 283.13 g/mol. Its IUPAC name is [(2S)-oxiran-2-yl]methyl 2,5-dichlorobenzenesulfonate.
| Compound Name | [(2S)-oxiran-2-yl]methyl 2,5-dichlorobenzenesulfonate |
|---|---|
| PubChem CID | 131857575 |
| Molecular Formula | C9H8Cl2O4S |
| Molecular Weight | 283.13 g/mol |
| Exact Mass | 281.95 |
| IUPAC Name | [(2S)-oxiran-2-yl]methyl 2,5-dichlorobenzenesulfonate |
| SMILES | O=S(=O)(OC[C@@H]1CO1)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C9H8Cl2O4S/c10-6-1-2-8(11)9(3-6)16(12,13)15-5-7-4-14-7/h1-3,7H,4-5H2/t7-/m0/s1 |
| InChIKey | LRWDOTJAMVJPGN-ZETCQYMHSA-N |
| XLogP | 2.10 |
| TPSA | 55.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.13 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|