C12H14Cl2O3S — CID 87077276
cyclohexyl 2,5-dichlorobenzenesulfonate (PubChem CID 87077276) has the molecular formula C12H14Cl2O3S and a molecular weight of 309.21 g/mol. Its IUPAC name is cyclohexyl 2,5-dichlorobenzenesulfonate.
| Compound Name | cyclohexyl 2,5-dichlorobenzenesulfonate |
|---|---|
| PubChem CID | 87077276 |
| Molecular Formula | C12H14Cl2O3S |
| Molecular Weight | 309.21 g/mol |
| Exact Mass | 308.00 |
| IUPAC Name | cyclohexyl 2,5-dichlorobenzenesulfonate |
| SMILES | O=S(=O)(OC1CCCCC1)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C12H14Cl2O3S/c13-9-6-7-11(14)12(8-9)18(15,16)17-10-4-2-1-3-5-10/h6-8,10H,1-5H2 |
| InChIKey | DROGWSKOBOUKEV-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.21 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|