C11H10Cl2O3S — CID 64641762
2-(2,5-dichlorophenyl)sulfonylcyclopentan-1-one (PubChem CID 64641762) has the molecular formula C11H10Cl2O3S and a molecular weight of 293.17 g/mol. Its IUPAC name is 2-(2,5-dichlorophenyl)sulfonylcyclopentan-1-one.
| Compound Name | 2-(2,5-dichlorophenyl)sulfonylcyclopentan-1-one |
|---|---|
| PubChem CID | 64641762 |
| Molecular Formula | C11H10Cl2O3S |
| Molecular Weight | 293.17 g/mol |
| Exact Mass | 291.97 |
| IUPAC Name | 2-(2,5-dichlorophenyl)sulfonylcyclopentan-1-one |
| SMILES | O=C1CCCC1S(=O)(=O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C11H10Cl2O3S/c12-7-4-5-8(13)11(6-7)17(15,16)10-3-1-2-9(10)14/h4-6,10H,1-3H2 |
| InChIKey | MVUFZKAFIYCFGN-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.17 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |