C13H17Cl2NO2S — CID 79863760
5-(2,5-dichlorophenyl)sulfonyl-2,2-dimethylcyclopentan-1-amine (PubChem CID 79863760) has the molecular formula C13H17Cl2NO2S and a molecular weight of 322.26 g/mol. Its IUPAC name is 5-(2,5-dichlorophenyl)sulfonyl-2,2-dimethylcyclopentan-1-amine.
| Compound Name | 5-(2,5-dichlorophenyl)sulfonyl-2,2-dimethylcyclopentan-1-amine |
|---|---|
| PubChem CID | 79863760 |
| Molecular Formula | C13H17Cl2NO2S |
| Molecular Weight | 322.26 g/mol |
| Exact Mass | 321.04 |
| IUPAC Name | 5-(2,5-dichlorophenyl)sulfonyl-2,2-dimethylcyclopentan-1-amine |
| SMILES | CC1(C)CCC(S(=O)(=O)c2cc(Cl)ccc2Cl)C1N |
| InChI | InChI=1S/C13H17Cl2NO2S/c1-13(2)6-5-10(12(13)16)19(17,18)11-7-8(14)3-4-9(11)15/h3-4,7,10,12H,5-6,16H2,1-2H3 |
| InChIKey | YANYCGMDWHLHKM-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.26 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |