C13H17Cl2NO3S — CID 98557309
2,5-dichloro-N-[(1S,2R)-2-hydroxycyclohexyl]-N-methylbenzenesulfonamide (PubChem CID 98557309) has the molecular formula C13H17Cl2NO3S and a molecular weight of 338.26 g/mol. Its IUPAC name is 2,5-dichloro-N-[(1S,2R)-2-hydroxycyclohexyl]-N-methylbenzenesulfonamide.
| Compound Name | 2,5-dichloro-N-[(1S,2R)-2-hydroxycyclohexyl]-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 98557309 |
| Molecular Formula | C13H17Cl2NO3S |
| Molecular Weight | 338.26 g/mol |
| Exact Mass | 337.03 |
| IUPAC Name | 2,5-dichloro-N-[(1S,2R)-2-hydroxycyclohexyl]-N-methylbenzenesulfonamide |
| SMILES | CN([C@H]1CCCC[C@H]1O)S(=O)(=O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C13H17Cl2NO3S/c1-16(11-4-2-3-5-12(11)17)20(18,19)13-8-9(14)6-7-10(13)15/h6-8,11-12,17H,2-5H2,1H3/t11-,12+/m0/s1 |
| InChIKey | SESBKUBHSBNBDL-NWDGAFQWSA-N |
| XLogP | 2.92 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.26 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |