C14H18Cl2N2O3S — CID 1315364
N-cyclopentyl-2-[(2,5-dichlorophenyl)sulfonyl-methylamino]acetamide (PubChem CID 1315364) has the molecular formula C14H18Cl2N2O3S and a molecular weight of 365.28 g/mol. Its IUPAC name is N-cyclopentyl-2-[(2,5-dichlorophenyl)sulfonyl-methylamino]acetamide.
| Compound Name | N-cyclopentyl-2-[(2,5-dichlorophenyl)sulfonyl-methylamino]acetamide |
|---|---|
| PubChem CID | 1315364 |
| Molecular Formula | C14H18Cl2N2O3S |
| Molecular Weight | 365.28 g/mol |
| Exact Mass | 364.04 |
| IUPAC Name | N-cyclopentyl-2-[(2,5-dichlorophenyl)sulfonyl-methylamino]acetamide |
| SMILES | CN(CC(=O)NC1CCCC1)S(=O)(=O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C14H18Cl2N2O3S/c1-18(9-14(19)17-11-4-2-3-5-11)22(20,21)13-8-10(15)6-7-12(13)16/h6-8,11H,2-5,9H2,1H3,(H,17,19) |
| InChIKey | PBTOOBWOBTZZQG-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.28 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |