C15H20Cl2N2O3S — CID 2239469
N-cyclopentyl-2-[(2,5-dichlorophenyl)sulfonyl-ethylamino]acetamide (PubChem CID 2239469) has the molecular formula C15H20Cl2N2O3S and a molecular weight of 379.31 g/mol. Its IUPAC name is N-cyclopentyl-2-[(2,5-dichlorophenyl)sulfonyl-ethylamino]acetamide.
| Compound Name | N-cyclopentyl-2-[(2,5-dichlorophenyl)sulfonyl-ethylamino]acetamide |
|---|---|
| PubChem CID | 2239469 |
| Molecular Formula | C15H20Cl2N2O3S |
| Molecular Weight | 379.31 g/mol |
| Exact Mass | 378.06 |
| IUPAC Name | N-cyclopentyl-2-[(2,5-dichlorophenyl)sulfonyl-ethylamino]acetamide |
| SMILES | CCN(CC(=O)NC1CCCC1)S(=O)(=O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C15H20Cl2N2O3S/c1-2-19(10-15(20)18-12-5-3-4-6-12)23(21,22)14-9-11(16)7-8-13(14)17/h7-9,12H,2-6,10H2,1H3,(H,18,20) |
| InChIKey | YIIOQHSZGXYZRN-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.31 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |