C13H17Cl2NO2S — CID 39116250
2,4-dichloro-N-cyclohexyl-N-methylbenzenesulfonamide (PubChem CID 39116250) has the molecular formula C13H17Cl2NO2S and a molecular weight of 322.26 g/mol. Its IUPAC name is 2,4-dichloro-N-cyclohexyl-N-methylbenzenesulfonamide.
| Compound Name | 2,4-dichloro-N-cyclohexyl-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 39116250 |
| Molecular Formula | C13H17Cl2NO2S |
| Molecular Weight | 322.26 g/mol |
| Exact Mass | 321.04 |
| IUPAC Name | 2,4-dichloro-N-cyclohexyl-N-methylbenzenesulfonamide |
| SMILES | CN(C1CCCCC1)S(=O)(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C13H17Cl2NO2S/c1-16(11-5-3-2-4-6-11)19(17,18)13-8-7-10(14)9-12(13)15/h7-9,11H,2-6H2,1H3 |
| InChIKey | OCPSOZXXEGPAQN-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.26 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |