C18H29NO2S — CID 90164879
2-tert-butyl-N-cyclohexyl-N,4-dimethylbenzenesulfonamide (PubChem CID 90164879) has the molecular formula C18H29NO2S and a molecular weight of 323.50 g/mol. Its IUPAC name is 2-tert-butyl-N-cyclohexyl-N,4-dimethylbenzenesulfonamide.
| Compound Name | 2-tert-butyl-N-cyclohexyl-N,4-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 90164879 |
| Molecular Formula | C18H29NO2S |
| Molecular Weight | 323.50 g/mol |
| Exact Mass | 323.19 |
| IUPAC Name | 2-tert-butyl-N-cyclohexyl-N,4-dimethylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N(C)C2CCCCC2)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C18H29NO2S/c1-14-11-12-17(16(13-14)18(2,3)4)22(20,21)19(5)15-9-7-6-8-10-15/h11-13,15H,6-10H2,1-5H3 |
| InChIKey | YNPSWRAPMTZUEM-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.50 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |