C13H18ClNO2S — CID 112823940
3-chloro-N-cyclopentyl-N,2-dimethylbenzenesulfonamide (PubChem CID 112823940) has the molecular formula C13H18ClNO2S and a molecular weight of 287.81 g/mol. Its IUPAC name is 3-chloro-N-cyclopentyl-N,2-dimethylbenzenesulfonamide.
| Compound Name | 3-chloro-N-cyclopentyl-N,2-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 112823940 |
| Molecular Formula | C13H18ClNO2S |
| Molecular Weight | 287.81 g/mol |
| Exact Mass | 287.07 |
| IUPAC Name | 3-chloro-N-cyclopentyl-N,2-dimethylbenzenesulfonamide |
| SMILES | Cc1c(Cl)cccc1S(=O)(=O)N(C)C1CCCC1 |
| InChI | InChI=1S/C13H18ClNO2S/c1-10-12(14)8-5-9-13(10)18(16,17)15(2)11-6-3-4-7-11/h5,8-9,11H,3-4,6-7H2,1-2H3 |
| InChIKey | WZAWSCRCONPEFJ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.81 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |