C14H19Cl2NO2S — CID 64638826
2-(2,5-dichlorophenyl)sulfonylcyclooctan-1-amine (PubChem CID 64638826) has the molecular formula C14H19Cl2NO2S and a molecular weight of 336.28 g/mol. Its IUPAC name is 2-(2,5-dichlorophenyl)sulfonylcyclooctan-1-amine.
| Compound Name | 2-(2,5-dichlorophenyl)sulfonylcyclooctan-1-amine |
|---|---|
| PubChem CID | 64638826 |
| Molecular Formula | C14H19Cl2NO2S |
| Molecular Weight | 336.28 g/mol |
| Exact Mass | 335.05 |
| IUPAC Name | 2-(2,5-dichlorophenyl)sulfonylcyclooctan-1-amine |
| SMILES | NC1CCCCCCC1S(=O)(=O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C14H19Cl2NO2S/c15-10-7-8-11(16)14(9-10)20(18,19)13-6-4-2-1-3-5-12(13)17/h7-9,12-13H,1-6,17H2 |
| InChIKey | JLFBECGFLSGABI-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.28 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |