C15H22Cl2N2O2S — CID 120775638
1-[2-(2,5-dichlorophenyl)sulfonylethyl]-3,3-dimethylpiperidin-4-amine (PubChem CID 120775638) has the molecular formula C15H22Cl2N2O2S and a molecular weight of 365.33 g/mol. Its IUPAC name is 1-[2-(2,5-dichlorophenyl)sulfonylethyl]-3,3-dimethylpiperidin-4-amine.
| Compound Name | 1-[2-(2,5-dichlorophenyl)sulfonylethyl]-3,3-dimethylpiperidin-4-amine |
|---|---|
| PubChem CID | 120775638 |
| Molecular Formula | C15H22Cl2N2O2S |
| Molecular Weight | 365.33 g/mol |
| Exact Mass | 364.08 |
| IUPAC Name | 1-[2-(2,5-dichlorophenyl)sulfonylethyl]-3,3-dimethylpiperidin-4-amine |
| SMILES | CC1(C)CN(CCS(=O)(=O)c2cc(Cl)ccc2Cl)CCC1N |
| InChI | InChI=1S/C15H22Cl2N2O2S/c1-15(2)10-19(6-5-14(15)18)7-8-22(20,21)13-9-11(16)3-4-12(13)17/h3-4,9,14H,5-8,10,18H2,1-2H3 |
| InChIKey | HVXYNPZNNPIUEN-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.33 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |