C20H24Cl2N2O3S — CID 78898556
1-[2-(2,5-dichlorophenyl)sulfonylethyl]-4-(4-methoxyphenyl)-1,4-diazepane (PubChem CID 78898556) has the molecular formula C20H24Cl2N2O3S and a molecular weight of 443.40 g/mol. Its IUPAC name is 1-[2-(2,5-dichlorophenyl)sulfonylethyl]-4-(4-methoxyphenyl)-1,4-diazepane.
| Compound Name | 1-[2-(2,5-dichlorophenyl)sulfonylethyl]-4-(4-methoxyphenyl)-1,4-diazepane |
|---|---|
| PubChem CID | 78898556 |
| Molecular Formula | C20H24Cl2N2O3S |
| Molecular Weight | 443.40 g/mol |
| Exact Mass | 442.09 |
| IUPAC Name | 1-[2-(2,5-dichlorophenyl)sulfonylethyl]-4-(4-methoxyphenyl)-1,4-diazepane |
| SMILES | COc1ccc(N2CCCN(CCS(=O)(=O)c3cc(Cl)ccc3Cl)CC2)cc1 |
| InChI | InChI=1S/C20H24Cl2N2O3S/c1-27-18-6-4-17(5-7-18)24-10-2-9-23(11-12-24)13-14-28(25,26)20-15-16(21)3-8-19(20)22/h3-8,15H,2,9-14H2,1H3 |
| InChIKey | ZBEYUOCVBBVVJC-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.40 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|