C20H21Cl2N3O2S — CID 55703278
4-[4-[2-(2,5-dichlorophenyl)sulfonylethyl]-1,4-diazepan-1-yl]benzonitrile (PubChem CID 55703278) has the molecular formula C20H21Cl2N3O2S and a molecular weight of 438.38 g/mol. Its IUPAC name is 4-[4-[2-(2,5-dichlorophenyl)sulfonylethyl]-1,4-diazepan-1-yl]benzonitrile.
| Compound Name | 4-[4-[2-(2,5-dichlorophenyl)sulfonylethyl]-1,4-diazepan-1-yl]benzonitrile |
|---|---|
| PubChem CID | 55703278 |
| Molecular Formula | C20H21Cl2N3O2S |
| Molecular Weight | 438.38 g/mol |
| Exact Mass | 437.07 |
| IUPAC Name | 4-[4-[2-(2,5-dichlorophenyl)sulfonylethyl]-1,4-diazepan-1-yl]benzonitrile |
| SMILES | N#Cc1ccc(N2CCCN(CCS(=O)(=O)c3cc(Cl)ccc3Cl)CC2)cc1 |
| InChI | InChI=1S/C20H21Cl2N3O2S/c21-17-4-7-19(22)20(14-17)28(26,27)13-12-24-8-1-9-25(11-10-24)18-5-2-16(15-23)3-6-18/h2-7,14H,1,8-13H2 |
| InChIKey | JFFQERTVPBFQPU-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 64.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.38 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |