C18H16Cl3N3O2S — CID 55872059
4-[4-(2,4,6-trichlorophenyl)sulfonyl-1,4-diazepan-1-yl]benzonitrile (PubChem CID 55872059) has the molecular formula C18H16Cl3N3O2S and a molecular weight of 444.77 g/mol. Its IUPAC name is 4-[4-(2,4,6-trichlorophenyl)sulfonyl-1,4-diazepan-1-yl]benzonitrile.
| Compound Name | 4-[4-(2,4,6-trichlorophenyl)sulfonyl-1,4-diazepan-1-yl]benzonitrile |
|---|---|
| PubChem CID | 55872059 |
| Molecular Formula | C18H16Cl3N3O2S |
| Molecular Weight | 444.77 g/mol |
| Exact Mass | 443.00 |
| IUPAC Name | 4-[4-(2,4,6-trichlorophenyl)sulfonyl-1,4-diazepan-1-yl]benzonitrile |
| SMILES | N#Cc1ccc(N2CCCN(S(=O)(=O)c3c(Cl)cc(Cl)cc3Cl)CC2)cc1 |
| InChI | InChI=1S/C18H16Cl3N3O2S/c19-14-10-16(20)18(17(21)11-14)27(25,26)24-7-1-6-23(8-9-24)15-4-2-13(12-22)3-5-15/h2-5,10-11H,1,6-9H2 |
| InChIKey | URNWZJRUGZTJGX-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 64.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.77 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |