C19H19F2N3O2S — CID 51119674
4-[4-[4-(difluoromethylsulfonyl)phenyl]-1,4-diazepan-1-yl]benzonitrile (PubChem CID 51119674) has the molecular formula C19H19F2N3O2S and a molecular weight of 391.44 g/mol. Its IUPAC name is 4-[4-[4-(difluoromethylsulfonyl)phenyl]-1,4-diazepan-1-yl]benzonitrile.
| Compound Name | 4-[4-[4-(difluoromethylsulfonyl)phenyl]-1,4-diazepan-1-yl]benzonitrile |
|---|---|
| PubChem CID | 51119674 |
| Molecular Formula | C19H19F2N3O2S |
| Molecular Weight | 391.44 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | 4-[4-[4-(difluoromethylsulfonyl)phenyl]-1,4-diazepan-1-yl]benzonitrile |
| SMILES | N#Cc1ccc(N2CCCN(c3ccc(S(=O)(=O)C(F)F)cc3)CC2)cc1 |
| InChI | InChI=1S/C19H19F2N3O2S/c20-19(21)27(25,26)18-8-6-17(7-9-18)24-11-1-10-23(12-13-24)16-4-2-15(14-22)3-5-16/h2-9,19H,1,10-13H2 |
| InChIKey | XGQFFECEQNCHFP-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 64.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.44 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |