About 4-fluorobenzonitrile;4-piperidin-1-ylbenzonitrile
4-fluorobenzonitrile;4-piperidin-1-ylbenzonitrile (PubChem CID 158355573) has the molecular formula C19H18FN3
and a molecular weight of 307.37 g/mol. Its IUPAC name is 4-fluorobenzonitrile;4-piperidin-1-ylbenzonitrile.
Molecular Properties
| Compound Name | 4-fluorobenzonitrile;4-piperidin-1-ylbenzonitrile |
| PubChem CID | 158355573 |
| Molecular Formula | C19H18FN3 |
| Molecular Weight | 307.37 g/mol |
| Exact Mass | 307.15 |
| IUPAC Name | 4-fluorobenzonitrile;4-piperidin-1-ylbenzonitrile |
| SMILES | N#Cc1ccc(F)cc1.N#Cc1ccc(N2CCCCC2)cc1 |
| InChI | InChI=1S/C12H14N2.C7H4FN/c13-10-11-4-6-12(7-5-11)14-8-2-1-3-9-14;8-7-3-1-6(5-9)2-4-7/h4-7H,1-3,8-9H2;1-4H |
| InChIKey | GSVHEVJLFANYAB-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 50.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.37 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-fluorobenzonitrile;4-piperidin-1-ylbenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluorobenzonitrile;4-piperidin-1-ylbenzonitrile?
The IUPAC name of 4-fluorobenzonitrile;4-piperidin-1-ylbenzonitrile (CID 158355573) is 4-fluorobenzonitrile;4-piperidin-1-ylbenzonitrile.
What is the SMILES notation for 4-fluorobenzonitrile;4-piperidin-1-ylbenzonitrile?
The canonical SMILES for 4-fluorobenzonitrile;4-piperidin-1-ylbenzonitrile is N#Cc1ccc(F)cc1.N#Cc1ccc(N2CCCCC2)cc1.
What is the InChIKey of 4-fluorobenzonitrile;4-piperidin-1-ylbenzonitrile?
The InChIKey is GSVHEVJLFANYAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2.C7H4FN/c13-10-11-4-6-12(7-5-11)14-8-2-1-3-9-14;8-7-3-1-6(5-9)2-4-7/h4-7H,1-3,8-9H2;1-4H.
What are the key properties of 4-fluorobenzonitrile;4-piperidin-1-ylbenzonitrile?
4-fluorobenzonitrile;4-piperidin-1-ylbenzonitrile has a molecular weight of 307.37 g/mol, XLogP of 4.25, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluorobenzonitrile;4-piperidin-1-ylbenzonitrile is sourced from PubChem (CID 158355573), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).