About cyclohexanamine;4-piperidin-1-ylbenzonitrile
cyclohexanamine;4-piperidin-1-ylbenzonitrile (PubChem CID 144513309) has the molecular formula C18H27N3
and a molecular weight of 285.44 g/mol. Its IUPAC name is cyclohexanamine;4-piperidin-1-ylbenzonitrile.
Molecular Properties
| Compound Name | cyclohexanamine;4-piperidin-1-ylbenzonitrile |
| PubChem CID | 144513309 |
| Molecular Formula | C18H27N3 |
| Molecular Weight | 285.44 g/mol |
| Exact Mass | 285.22 |
| IUPAC Name | cyclohexanamine;4-piperidin-1-ylbenzonitrile |
| SMILES | N#Cc1ccc(N2CCCCC2)cc1.NC1CCCCC1 |
| InChI | InChI=1S/C12H14N2.C6H13N/c13-10-11-4-6-12(7-5-11)14-8-2-1-3-9-14;7-6-4-2-1-3-5-6/h4-7H,1-3,8-9H2;6H,1-5,7H2 |
| InChIKey | ZKNMJUYJVSUNHV-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 53.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.44 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze cyclohexanamine;4-piperidin-1-ylbenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexanamine;4-piperidin-1-ylbenzonitrile?
The IUPAC name of cyclohexanamine;4-piperidin-1-ylbenzonitrile (CID 144513309) is cyclohexanamine;4-piperidin-1-ylbenzonitrile.
What is the SMILES notation for cyclohexanamine;4-piperidin-1-ylbenzonitrile?
The canonical SMILES for cyclohexanamine;4-piperidin-1-ylbenzonitrile is N#Cc1ccc(N2CCCCC2)cc1.NC1CCCCC1.
What is the InChIKey of cyclohexanamine;4-piperidin-1-ylbenzonitrile?
The InChIKey is ZKNMJUYJVSUNHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2.C6H13N/c13-10-11-4-6-12(7-5-11)14-8-2-1-3-9-14;7-6-4-2-1-3-5-6/h4-7H,1-3,8-9H2;6H,1-5,7H2.
What are the key properties of cyclohexanamine;4-piperidin-1-ylbenzonitrile?
cyclohexanamine;4-piperidin-1-ylbenzonitrile has a molecular weight of 285.44 g/mol, XLogP of 3.83, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexanamine;4-piperidin-1-ylbenzonitrile is sourced from PubChem (CID 144513309), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).