About (2R)-1-[2-(2,5-dichlorophenyl)sulfonylethyl]-2-thiophen-2-ylpyrrolidine
(2R)-1-[2-(2,5-dichlorophenyl)sulfonylethyl]-2-thiophen-2-ylpyrrolidine (PubChem CID 9446271) has the molecular formula C16H17Cl2NO2S2
and a molecular weight of 390.36 g/mol. Its IUPAC name is (2R)-1-[2-(2,5-dichlorophenyl)sulfonylethyl]-2-thiophen-2-ylpyrrolidine.
Molecular Properties
| Compound Name | (2R)-1-[2-(2,5-dichlorophenyl)sulfonylethyl]-2-thiophen-2-ylpyrrolidine |
| PubChem CID | 9446271 |
| Molecular Formula | C16H17Cl2NO2S2 |
| Molecular Weight | 390.36 g/mol |
| Exact Mass | 389.01 |
| IUPAC Name | (2R)-1-[2-(2,5-dichlorophenyl)sulfonylethyl]-2-thiophen-2-ylpyrrolidine |
| SMILES | O=S(=O)(CCN1CCC[C@@H]1c1cccs1)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C16H17Cl2NO2S2/c17-12-5-6-13(18)16(11-12)23(20,21)10-8-19-7-1-3-14(19)15-4-2-9-22-15/h2,4-6,9,11,14H,1,3,7-8,10H2/t14-/m1/s1 |
| InChIKey | VIHSCSCCTBSBLZ-CQSZACIVSA-N |
| XLogP | 4.67 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.36 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2R)-1-[2-(2,5-dichlorophenyl)sulfonylethyl]-2-thiophen-2-ylpyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-1-[2-(2,5-dichlorophenyl)sulfonylethyl]-2-thiophen-2-ylpyrrolidine?
The IUPAC name of (2R)-1-[2-(2,5-dichlorophenyl)sulfonylethyl]-2-thiophen-2-ylpyrrolidine (CID 9446271) is (2R)-1-[2-(2,5-dichlorophenyl)sulfonylethyl]-2-thiophen-2-ylpyrrolidine.
What is the SMILES notation for (2R)-1-[2-(2,5-dichlorophenyl)sulfonylethyl]-2-thiophen-2-ylpyrrolidine?
The canonical SMILES for (2R)-1-[2-(2,5-dichlorophenyl)sulfonylethyl]-2-thiophen-2-ylpyrrolidine is O=S(=O)(CCN1CCC[C@@H]1c1cccs1)c1cc(Cl)ccc1Cl.
What is the InChIKey of (2R)-1-[2-(2,5-dichlorophenyl)sulfonylethyl]-2-thiophen-2-ylpyrrolidine?
The InChIKey is VIHSCSCCTBSBLZ-CQSZACIVSA-N. The full InChI is InChI=1S/C16H17Cl2NO2S2/c17-12-5-6-13(18)16(11-12)23(20,21)10-8-19-7-1-3-14(19)15-4-2-9-22-15/h2,4-6,9,11,14H,1,3,7-8,10H2/t14-/m1/s1.
What are the key properties of (2R)-1-[2-(2,5-dichlorophenyl)sulfonylethyl]-2-thiophen-2-ylpyrrolidine?
(2R)-1-[2-(2,5-dichlorophenyl)sulfonylethyl]-2-thiophen-2-ylpyrrolidine has a molecular weight of 390.36 g/mol, XLogP of 4.67, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-1-[2-(2,5-dichlorophenyl)sulfonylethyl]-2-thiophen-2-ylpyrrolidine is sourced from PubChem (CID 9446271), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).