C16H17Cl2NO2S2 — CID 9446271
(2R)-1-[2-(2,5-dichlorophenyl)sulfonylethyl]-2-thiophen-2-ylpyrrolidine (PubChem CID 9446271) has the molecular formula C16H17Cl2NO2S2 and a molecular weight of 390.36 g/mol. Its IUPAC name is (2R)-1-[2-(2,5-dichlorophenyl)sulfonylethyl]-2-thiophen-2-ylpyrrolidine.
| Compound Name | (2R)-1-[2-(2,5-dichlorophenyl)sulfonylethyl]-2-thiophen-2-ylpyrrolidine |
|---|---|
| PubChem CID | 9446271 |
| Molecular Formula | C16H17Cl2NO2S2 |
| Molecular Weight | 390.36 g/mol |
| Exact Mass | 389.01 |
| IUPAC Name | (2R)-1-[2-(2,5-dichlorophenyl)sulfonylethyl]-2-thiophen-2-ylpyrrolidine |
| SMILES | O=S(=O)(CCN1CCC[C@@H]1c1cccs1)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C16H17Cl2NO2S2/c17-12-5-6-13(18)16(11-12)23(20,21)10-8-19-7-1-3-14(19)15-4-2-9-22-15/h2,4-6,9,11,14H,1,3,7-8,10H2/t14-/m1/s1 |
| InChIKey | VIHSCSCCTBSBLZ-CQSZACIVSA-N |
| XLogP | 4.67 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.36 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |