C16H16ClN5S2 — CID 9244747
1-(3-chlorophenyl)-4-[[(2S)-2-thiophen-2-ylpyrrolidin-1-yl]methyl]tetrazole-5-thione (PubChem CID 9244747) has the molecular formula C16H16ClN5S2 and a molecular weight of 377.93 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-4-[[(2S)-2-thiophen-2-ylpyrrolidin-1-yl]methyl]tetrazole-5-thione.
| Compound Name | 1-(3-chlorophenyl)-4-[[(2S)-2-thiophen-2-ylpyrrolidin-1-yl]methyl]tetrazole-5-thione |
|---|---|
| PubChem CID | 9244747 |
| Molecular Formula | C16H16ClN5S2 |
| Molecular Weight | 377.93 g/mol |
| Exact Mass | 377.05 |
| IUPAC Name | 1-(3-chlorophenyl)-4-[[(2S)-2-thiophen-2-ylpyrrolidin-1-yl]methyl]tetrazole-5-thione |
| SMILES | S=c1n(CN2CCC[C@H]2c2cccs2)nnn1-c1cccc(Cl)c1 |
| InChI | InChI=1S/C16H16ClN5S2/c17-12-4-1-5-13(10-12)22-16(23)21(18-19-22)11-20-8-2-6-14(20)15-7-3-9-24-15/h1,3-5,7,9-10,14H,2,6,8,11H2/t14-/m0/s1 |
| InChIKey | BMUHDGUCDJTPBM-AWEZNQCLSA-N |
| XLogP | 4.31 |
| TPSA | 38.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.93 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|