C14H15N5OS2 — CID 9245005
1-thiophen-2-yl-4-[[(2S)-2-thiophen-2-ylpyrrolidin-1-yl]methyl]tetrazol-5-one (PubChem CID 9245005) has the molecular formula C14H15N5OS2 and a molecular weight of 333.44 g/mol. Its IUPAC name is 1-thiophen-2-yl-4-[[(2S)-2-thiophen-2-ylpyrrolidin-1-yl]methyl]tetrazol-5-one.
| Compound Name | 1-thiophen-2-yl-4-[[(2S)-2-thiophen-2-ylpyrrolidin-1-yl]methyl]tetrazol-5-one |
|---|---|
| PubChem CID | 9245005 |
| Molecular Formula | C14H15N5OS2 |
| Molecular Weight | 333.44 g/mol |
| Exact Mass | 333.07 |
| IUPAC Name | 1-thiophen-2-yl-4-[[(2S)-2-thiophen-2-ylpyrrolidin-1-yl]methyl]tetrazol-5-one |
| SMILES | O=c1n(CN2CCC[C@H]2c2cccs2)nnn1-c1cccs1 |
| InChI | InChI=1S/C14H15N5OS2/c20-14-18(15-16-19(14)13-6-3-9-22-13)10-17-7-1-4-11(17)12-5-2-8-21-12/h2-3,5-6,8-9,11H,1,4,7,10H2/t11-/m0/s1 |
| InChIKey | DADMKTMMXGCDHD-NSHDSACASA-N |
| XLogP | 2.35 |
| TPSA | 55.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.44 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |