C15H19N5O3S — CID 56796159
1-[2-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl)-2-oxoethyl]-4-thiophen-2-yltetrazol-5-one (PubChem CID 56796159) has the molecular formula C15H19N5O3S and a molecular weight of 349.42 g/mol. Its IUPAC name is 1-[2-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl)-2-oxoethyl]-4-thiophen-2-yltetrazol-5-one.
| Compound Name | 1-[2-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl)-2-oxoethyl]-4-thiophen-2-yltetrazol-5-one |
|---|---|
| PubChem CID | 56796159 |
| Molecular Formula | C15H19N5O3S |
| Molecular Weight | 349.42 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | 1-[2-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl)-2-oxoethyl]-4-thiophen-2-yltetrazol-5-one |
| SMILES | O=C(Cn1nnn(-c2cccs2)c1=O)N1CCOC2CCCCC21 |
| InChI | InChI=1S/C15H19N5O3S/c21-13(18-7-8-23-12-5-2-1-4-11(12)18)10-19-15(22)20(17-16-19)14-6-3-9-24-14/h3,6,9,11-12H,1-2,4-5,7-8,10H2 |
| InChIKey | NFPSGVOOHBVHBR-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 82.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.42 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |