C17H24N2O2S — CID 94435857
1-[(4aS,8aS)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl]-2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)ethanone (PubChem CID 94435857) has the molecular formula C17H24N2O2S and a molecular weight of 320.46 g/mol. Its IUPAC name is 1-[(4aS,8aS)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl]-2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)ethanone.
| Compound Name | 1-[(4aS,8aS)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl]-2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)ethanone |
|---|---|
| PubChem CID | 94435857 |
| Molecular Formula | C17H24N2O2S |
| Molecular Weight | 320.46 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | 1-[(4aS,8aS)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl]-2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)ethanone |
| SMILES | O=C(CN1CCc2sccc2C1)N1CCO[C@H]2CCCC[C@@H]21 |
| InChI | InChI=1S/C17H24N2O2S/c20-17(12-18-7-5-16-13(11-18)6-10-22-16)19-8-9-21-15-4-2-1-3-14(15)19/h6,10,14-15H,1-5,7-9,11-12H2/t14-,15-/m0/s1 |
| InChIKey | ZCXPFHRXHQSPAR-GJZGRUSLSA-N |
| XLogP | 2.28 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.46 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |