C19H19N3O3S — CID 9244879
1-(4-methylphenyl)-3-[[(2S)-2-thiophen-2-ylpyrrolidin-1-yl]methyl]imidazolidine-2,4,5-trione (PubChem CID 9244879) has the molecular formula C19H19N3O3S and a molecular weight of 369.45 g/mol. Its IUPAC name is 1-(4-methylphenyl)-3-[[(2S)-2-thiophen-2-ylpyrrolidin-1-yl]methyl]imidazolidine-2,4,5-trione.
| Compound Name | 1-(4-methylphenyl)-3-[[(2S)-2-thiophen-2-ylpyrrolidin-1-yl]methyl]imidazolidine-2,4,5-trione |
|---|---|
| PubChem CID | 9244879 |
| Molecular Formula | C19H19N3O3S |
| Molecular Weight | 369.45 g/mol |
| Exact Mass | 369.11 |
| IUPAC Name | 1-(4-methylphenyl)-3-[[(2S)-2-thiophen-2-ylpyrrolidin-1-yl]methyl]imidazolidine-2,4,5-trione |
| SMILES | Cc1ccc(N2C(=O)C(=O)N(CN3CCC[C@H]3c3cccs3)C2=O)cc1 |
| InChI | InChI=1S/C19H19N3O3S/c1-13-6-8-14(9-7-13)22-18(24)17(23)21(19(22)25)12-20-10-2-4-15(20)16-5-3-11-26-16/h3,5-9,11,15H,2,4,10,12H2,1H3/t15-/m0/s1 |
| InChIKey | ZKWFXGAUSKGYLW-HNNXBMFYSA-N |
| XLogP | 3.15 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.45 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|