C14H17N8OS+ — CID 9232367
1-[(4-pyrimidin-2-ylpiperazin-1-ium-1-yl)methyl]-4-thiophen-2-yltetrazol-5-one (PubChem CID 9232367) has the molecular formula C14H17N8OS+ and a molecular weight of 345.41 g/mol. Its IUPAC name is 1-[(4-pyrimidin-2-ylpiperazin-1-ium-1-yl)methyl]-4-thiophen-2-yltetrazol-5-one.
| Compound Name | 1-[(4-pyrimidin-2-ylpiperazin-1-ium-1-yl)methyl]-4-thiophen-2-yltetrazol-5-one |
|---|---|
| PubChem CID | 9232367 |
| Molecular Formula | C14H17N8OS+ |
| Molecular Weight | 345.41 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | 1-[(4-pyrimidin-2-ylpiperazin-1-ium-1-yl)methyl]-4-thiophen-2-yltetrazol-5-one |
| SMILES | O=c1n(C[NH+]2CCN(c3ncccn3)CC2)nnn1-c1cccs1 |
| InChI | InChI=1S/C14H16N8OS/c23-14-21(17-18-22(14)12-3-1-10-24-12)11-19-6-8-20(9-7-19)13-15-4-2-5-16-13/h1-5,10H,6-9,11H2/p+1 |
| InChIKey | JMEWUPSFDDJBGS-UHFFFAOYSA-O |
| XLogP | -1.36 |
| TPSA | 86.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.41 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |