C17H24N5O2+ — CID 7480071
(3aS,7aS)-2-[(4-pyrimidin-2-ylpiperazin-1-ium-1-yl)methyl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione (PubChem CID 7480071) has the molecular formula C17H24N5O2+ and a molecular weight of 330.41 g/mol. Its IUPAC name is (3aS,7aS)-2-[(4-pyrimidin-2-ylpiperazin-1-ium-1-yl)methyl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione.
| Compound Name | (3aS,7aS)-2-[(4-pyrimidin-2-ylpiperazin-1-ium-1-yl)methyl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 7480071 |
| Molecular Formula | C17H24N5O2+ |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | (3aS,7aS)-2-[(4-pyrimidin-2-ylpiperazin-1-ium-1-yl)methyl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione |
| SMILES | O=C1[C@H]2CCCC[C@@H]2C(=O)N1C[NH+]1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C17H23N5O2/c23-15-13-4-1-2-5-14(13)16(24)22(15)12-20-8-10-21(11-9-20)17-18-6-3-7-19-17/h3,6-7,13-14H,1-2,4-5,8-12H2/p+1/t13-,14-/m0/s1 |
| InChIKey | ZRIRBLBRRLJKMN-KBPBESRZSA-O |
| XLogP | -0.69 |
| TPSA | 70.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|