C22H32N6O3 — CID 46632562
3-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]propanamide (PubChem CID 46632562) has the molecular formula C22H32N6O3 and a molecular weight of 428.54 g/mol. Its IUPAC name is 3-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]propanamide.
| Compound Name | 3-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]propanamide |
|---|---|
| PubChem CID | 46632562 |
| Molecular Formula | C22H32N6O3 |
| Molecular Weight | 428.54 g/mol |
| Exact Mass | 428.25 |
| IUPAC Name | 3-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]propanamide |
| SMILES | O=C(CCN1C(=O)C2CCCCC2C1=O)NCCCN1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C22H32N6O3/c29-19(7-12-28-20(30)17-5-1-2-6-18(17)21(28)31)23-10-4-11-26-13-15-27(16-14-26)22-24-8-3-9-25-22/h3,8-9,17-18H,1-2,4-7,10-16H2,(H,23,29) |
| InChIKey | NRKYOFVMXYWJIB-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.54 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|