C23H31N5O2 — CID 39539883
4-(4-ethylphenyl)-4-oxo-N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]butanamide (PubChem CID 39539883) has the molecular formula C23H31N5O2 and a molecular weight of 409.53 g/mol. Its IUPAC name is 4-(4-ethylphenyl)-4-oxo-N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]butanamide.
| Compound Name | 4-(4-ethylphenyl)-4-oxo-N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]butanamide |
|---|---|
| PubChem CID | 39539883 |
| Molecular Formula | C23H31N5O2 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.25 |
| IUPAC Name | 4-(4-ethylphenyl)-4-oxo-N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]butanamide |
| SMILES | CCc1ccc(C(=O)CCC(=O)NCCCN2CCN(c3ncccn3)CC2)cc1 |
| InChI | InChI=1S/C23H31N5O2/c1-2-19-5-7-20(8-6-19)21(29)9-10-22(30)24-13-4-14-27-15-17-28(18-16-27)23-25-11-3-12-26-23/h3,5-8,11-12H,2,4,9-10,13-18H2,1H3,(H,24,30) |
| InChIKey | STTWQQWKDOJCQE-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|