C14H25ClN6O — CID 120703590
2-(methylamino)-N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]acetamide;hydrochloride (PubChem CID 120703590) has the molecular formula C14H25ClN6O and a molecular weight of 328.85 g/mol. Its IUPAC name is 2-(methylamino)-N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]acetamide;hydrochloride.
| Compound Name | 2-(methylamino)-N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 120703590 |
| Molecular Formula | C14H25ClN6O |
| Molecular Weight | 328.85 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | 2-(methylamino)-N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]acetamide;hydrochloride |
| SMILES | CNCC(=O)NCCCN1CCN(c2ncccn2)CC1.Cl |
| InChI | InChI=1S/C14H24N6O.ClH/c1-15-12-13(21)16-6-3-7-19-8-10-20(11-9-19)14-17-4-2-5-18-14;/h2,4-5,15H,3,6-12H2,1H3,(H,16,21);1H |
| InChIKey | IXHYKGKEMBMOKK-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.85 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|