C21H28N6O2 — CID 31413720
2-(4-acetamidophenyl)-N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]acetamide (PubChem CID 31413720) has the molecular formula C21H28N6O2 and a molecular weight of 396.50 g/mol. Its IUPAC name is 2-(4-acetamidophenyl)-N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]acetamide.
| Compound Name | 2-(4-acetamidophenyl)-N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]acetamide |
|---|---|
| PubChem CID | 31413720 |
| Molecular Formula | C21H28N6O2 |
| Molecular Weight | 396.50 g/mol |
| Exact Mass | 396.23 |
| IUPAC Name | 2-(4-acetamidophenyl)-N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]acetamide |
| SMILES | CC(=O)Nc1ccc(CC(=O)NCCCN2CCN(c3ncccn3)CC2)cc1 |
| InChI | InChI=1S/C21H28N6O2/c1-17(28)25-19-6-4-18(5-7-19)16-20(29)22-10-3-11-26-12-14-27(15-13-26)21-23-8-2-9-24-21/h2,4-9H,3,10-16H2,1H3,(H,22,29)(H,25,28) |
| InChIKey | OXNVRMZJCKIMHY-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.50 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|