C22H29ClN6O2 — CID 55618227
3-acetamido-3-(4-chlorophenyl)-N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]propanamide (PubChem CID 55618227) has the molecular formula C22H29ClN6O2 and a molecular weight of 444.97 g/mol. Its IUPAC name is 3-acetamido-3-(4-chlorophenyl)-N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]propanamide.
| Compound Name | 3-acetamido-3-(4-chlorophenyl)-N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]propanamide |
|---|---|
| PubChem CID | 55618227 |
| Molecular Formula | C22H29ClN6O2 |
| Molecular Weight | 444.97 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | 3-acetamido-3-(4-chlorophenyl)-N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]propanamide |
| SMILES | CC(=O)NC(CC(=O)NCCCN1CCN(c2ncccn2)CC1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H29ClN6O2/c1-17(30)27-20(18-4-6-19(23)7-5-18)16-21(31)24-10-3-11-28-12-14-29(15-13-28)22-25-8-2-9-26-22/h2,4-9,20H,3,10-16H2,1H3,(H,24,31)(H,27,30) |
| InChIKey | QHKURGJOZSJYFY-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.97 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|