C21H27Cl2N5O2 — CID 39539485
4-(2,4-dichlorophenoxy)-N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]butanamide (PubChem CID 39539485) has the molecular formula C21H27Cl2N5O2 and a molecular weight of 452.39 g/mol. Its IUPAC name is 4-(2,4-dichlorophenoxy)-N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]butanamide.
| Compound Name | 4-(2,4-dichlorophenoxy)-N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]butanamide |
|---|---|
| PubChem CID | 39539485 |
| Molecular Formula | C21H27Cl2N5O2 |
| Molecular Weight | 452.39 g/mol |
| Exact Mass | 451.15 |
| IUPAC Name | 4-(2,4-dichlorophenoxy)-N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]butanamide |
| SMILES | O=C(CCCOc1ccc(Cl)cc1Cl)NCCCN1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C21H27Cl2N5O2/c22-17-5-6-19(18(23)16-17)30-15-1-4-20(29)24-9-3-10-27-11-13-28(14-12-27)21-25-7-2-8-26-21/h2,5-8,16H,1,3-4,9-15H2,(H,24,29) |
| InChIKey | CMKFBMVDLZMRRC-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.39 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|