C17H20Cl2N4O2 — CID 31061722
(2R)-1-(2,4-dichlorophenoxy)-3-(4-pyrimidin-2-ylpiperazin-1-yl)propan-2-ol (PubChem CID 31061722) has the molecular formula C17H20Cl2N4O2 and a molecular weight of 383.28 g/mol. Its IUPAC name is (2R)-1-(2,4-dichlorophenoxy)-3-(4-pyrimidin-2-ylpiperazin-1-yl)propan-2-ol.
| Compound Name | (2R)-1-(2,4-dichlorophenoxy)-3-(4-pyrimidin-2-ylpiperazin-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 31061722 |
| Molecular Formula | C17H20Cl2N4O2 |
| Molecular Weight | 383.28 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | (2R)-1-(2,4-dichlorophenoxy)-3-(4-pyrimidin-2-ylpiperazin-1-yl)propan-2-ol |
| SMILES | O[C@@H](COc1ccc(Cl)cc1Cl)CN1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C17H20Cl2N4O2/c18-13-2-3-16(15(19)10-13)25-12-14(24)11-22-6-8-23(9-7-22)17-20-4-1-5-21-17/h1-5,10,14,24H,6-9,11-12H2/t14-/m1/s1 |
| InChIKey | VJALIGBONUZJEI-CQSZACIVSA-N |
| XLogP | 2.35 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.28 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |