C26H28Cl2N2O2 — CID 2917495
1-(4-benzhydrylpiperazin-1-yl)-3-(2,4-dichlorophenoxy)propan-2-ol (PubChem CID 2917495) has the molecular formula C26H28Cl2N2O2 and a molecular weight of 471.43 g/mol. Its IUPAC name is 1-(4-benzhydrylpiperazin-1-yl)-3-(2,4-dichlorophenoxy)propan-2-ol.
| Compound Name | 1-(4-benzhydrylpiperazin-1-yl)-3-(2,4-dichlorophenoxy)propan-2-ol |
|---|---|
| PubChem CID | 2917495 |
| Molecular Formula | C26H28Cl2N2O2 |
| Molecular Weight | 471.43 g/mol |
| Exact Mass | 470.15 |
| IUPAC Name | 1-(4-benzhydrylpiperazin-1-yl)-3-(2,4-dichlorophenoxy)propan-2-ol |
| SMILES | OC(COc1ccc(Cl)cc1Cl)CN1CCN(C(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C26H28Cl2N2O2/c27-22-11-12-25(24(28)17-22)32-19-23(31)18-29-13-15-30(16-14-29)26(20-7-3-1-4-8-20)21-9-5-2-6-10-21/h1-12,17,23,26,31H,13-16,18-19H2 |
| InChIKey | ITJVTCKCBYZQEQ-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.43 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |