C33H34Cl2N2O2 — CID 98291992
(2R)-1-(4-benzhydrylpiperazin-1-yl)-3-[bis(4-chlorophenyl)methoxy]propan-2-ol (PubChem CID 98291992) has the molecular formula C33H34Cl2N2O2 and a molecular weight of 561.55 g/mol. Its IUPAC name is (2R)-1-(4-benzhydrylpiperazin-1-yl)-3-[bis(4-chlorophenyl)methoxy]propan-2-ol.
| Compound Name | (2R)-1-(4-benzhydrylpiperazin-1-yl)-3-[bis(4-chlorophenyl)methoxy]propan-2-ol |
|---|---|
| PubChem CID | 98291992 |
| Molecular Formula | C33H34Cl2N2O2 |
| Molecular Weight | 561.55 g/mol |
| Exact Mass | 560.20 |
| IUPAC Name | (2R)-1-(4-benzhydrylpiperazin-1-yl)-3-[bis(4-chlorophenyl)methoxy]propan-2-ol |
| SMILES | O[C@@H](COC(c1ccc(Cl)cc1)c1ccc(Cl)cc1)CN1CCN(C(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C33H34Cl2N2O2/c34-29-15-11-27(12-16-29)33(28-13-17-30(35)18-14-28)39-24-31(38)23-36-19-21-37(22-20-36)32(25-7-3-1-4-8-25)26-9-5-2-6-10-26/h1-18,31-33,38H,19-24H2/t31-/m1/s1 |
| InChIKey | HOJOIDZRPNIDCC-WJOKGBTCSA-N |
| XLogP | 6.87 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.55 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |